C22H18N4O2S — CID 169364570
3-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-(2-phenylanilino)benzoic acid (PubChem CID 169364570) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is 3-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-(2-phenylanilino)benzoic acid.
| Compound Name | 3-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-(2-phenylanilino)benzoic acid |
|---|---|
| PubChem CID | 169364570 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 3-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-(2-phenylanilino)benzoic acid |
| SMILES | CS/C(=N\c1cccc(C(=O)O)c1Nc1ccccc1-c1ccccc1)NC#N |
| InChI | InChI=1S/C22H18N4O2S/c1-29-22(24-14-23)26-19-13-7-11-17(21(27)28)20(19)25-18-12-6-5-10-16(18)15-8-3-2-4-9-15/h2-13,25H,1H3,(H,24,26)(H,27,28) |
| InChIKey | PGWQJAXKOOCQSN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|