C11H12N4O2S — CID 169363895
3-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-(methylamino)benzoic acid (PubChem CID 169363895) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is 3-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-(methylamino)benzoic acid.
| Compound Name | 3-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-(methylamino)benzoic acid |
|---|---|
| PubChem CID | 169363895 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 3-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-(methylamino)benzoic acid |
| SMILES | CNc1c(/N=C(/NC#N)SC)cccc1C(=O)O |
| InChI | InChI=1S/C11H12N4O2S/c1-13-9-7(10(16)17)4-3-5-8(9)15-11(18-2)14-6-12/h3-5,13H,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | NVIBJOICSXPJFK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|