C13H11N3O3S2 — CID 169364615
5-[[(cyanoamino)-methylsulfanylmethylidene]amino]naphthalene-1-sulfonic acid (PubChem CID 169364615) has the molecular formula C13H11N3O3S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 5-[[(cyanoamino)-methylsulfanylmethylidene]amino]naphthalene-1-sulfonic acid.
| Compound Name | 5-[[(cyanoamino)-methylsulfanylmethylidene]amino]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 169364615 |
| Molecular Formula | C13H11N3O3S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 5-[[(cyanoamino)-methylsulfanylmethylidene]amino]naphthalene-1-sulfonic acid |
| SMILES | CS/C(=N\c1cccc2c(S(=O)(=O)O)cccc12)NC#N |
| InChI | InChI=1S/C13H11N3O3S2/c1-20-13(15-8-14)16-11-6-2-5-10-9(11)4-3-7-12(10)21(17,18)19/h2-7H,1H3,(H,15,16)(H,17,18,19) |
| InChIKey | UJDCAACJQINUDQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|