C16H14ClN3S2 — CID 169363665
methyl N'-[2-[(3-chlorophenyl)methylsulfanyl]phenyl]-N-cyanocarbamimidothioate (PubChem CID 169363665) has the molecular formula C16H14ClN3S2 and a molecular weight of 347.90 g/mol. Its IUPAC name is methyl N'-[2-[(3-chlorophenyl)methylsulfanyl]phenyl]-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-[2-[(3-chlorophenyl)methylsulfanyl]phenyl]-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169363665 |
| Molecular Formula | C16H14ClN3S2 |
| Molecular Weight | 347.90 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | methyl N'-[2-[(3-chlorophenyl)methylsulfanyl]phenyl]-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1ccccc1SCc1cccc(Cl)c1)NC#N |
| InChI | InChI=1S/C16H14ClN3S2/c1-21-16(19-11-18)20-14-7-2-3-8-15(14)22-10-12-5-4-6-13(17)9-12/h2-9H,10H2,1H3,(H,19,20) |
| InChIKey | QTVFQGIRLABGSP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.90 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|