C13H12ClN5S — CID 169362699
methyl N'-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]-N-cyanocarbamimidothioate (PubChem CID 169362699) has the molecular formula C13H12ClN5S and a molecular weight of 305.79 g/mol. Its IUPAC name is methyl N'-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169362699 |
| Molecular Formula | C13H12ClN5S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | methyl N'-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1cccc(Cn2cc(Cl)cn2)c1)NC#N |
| InChI | InChI=1S/C13H12ClN5S/c1-20-13(16-9-15)18-12-4-2-3-10(5-12)7-19-8-11(14)6-17-19/h2-6,8H,7H2,1H3,(H,16,18) |
| InChIKey | CYZWCEFDNHGFLC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|