C16H16N4S — CID 169361139
methyl N'-[4-(benzylamino)phenyl]-N-cyanocarbamimidothioate (PubChem CID 169361139) has the molecular formula C16H16N4S and a molecular weight of 296.40 g/mol. Its IUPAC name is methyl N'-[4-(benzylamino)phenyl]-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-[4-(benzylamino)phenyl]-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169361139 |
| Molecular Formula | C16H16N4S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | methyl N'-[4-(benzylamino)phenyl]-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1ccc(NCc2ccccc2)cc1)NC#N |
| InChI | InChI=1S/C16H16N4S/c1-21-16(19-12-17)20-15-9-7-14(8-10-15)18-11-13-5-3-2-4-6-13/h2-10,18H,11H2,1H3,(H,19,20) |
| InChIKey | DYDPJEOLNJGHIM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|