C16H23N5S — CID 169361341
methyl N-cyano-N'-[4-[[(1-methylpiperidin-4-yl)amino]methyl]phenyl]carbamimidothioate (PubChem CID 169361341) has the molecular formula C16H23N5S and a molecular weight of 317.46 g/mol. Its IUPAC name is methyl N-cyano-N'-[4-[[(1-methylpiperidin-4-yl)amino]methyl]phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[4-[[(1-methylpiperidin-4-yl)amino]methyl]phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169361341 |
| Molecular Formula | C16H23N5S |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | methyl N-cyano-N'-[4-[[(1-methylpiperidin-4-yl)amino]methyl]phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1ccc(CNC2CCN(C)CC2)cc1)NC#N |
| InChI | InChI=1S/C16H23N5S/c1-21-9-7-14(8-10-21)18-11-13-3-5-15(6-4-13)20-16(22-2)19-12-17/h3-6,14,18H,7-11H2,1-2H3,(H,19,20) |
| InChIKey | ZVEJAWNOHSQQMD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|