C16H28N2Si — CID 103437564
1-methyl-N-[(4-trimethylsilylphenyl)methyl]piperidin-4-amine (PubChem CID 103437564) has the molecular formula C16H28N2Si and a molecular weight of 276.50 g/mol. Its IUPAC name is 1-methyl-N-[(4-trimethylsilylphenyl)methyl]piperidin-4-amine.
| Compound Name | 1-methyl-N-[(4-trimethylsilylphenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 103437564 |
| Molecular Formula | C16H28N2Si |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 1-methyl-N-[(4-trimethylsilylphenyl)methyl]piperidin-4-amine |
| SMILES | CN1CCC(NCc2ccc([Si](C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C16H28N2Si/c1-18-11-9-15(10-12-18)17-13-14-5-7-16(8-6-14)19(2,3)4/h5-8,15,17H,9-13H2,1-4H3 |
| InChIKey | DOJOHKCWKIUBDW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|