C17H27N3 — CID 43280922
N-[4-[(cyclopropylamino)methyl]phenyl]-N,1-dimethylpiperidin-4-amine (PubChem CID 43280922) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is N-[4-[(cyclopropylamino)methyl]phenyl]-N,1-dimethylpiperidin-4-amine.
| Compound Name | N-[4-[(cyclopropylamino)methyl]phenyl]-N,1-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 43280922 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | N-[4-[(cyclopropylamino)methyl]phenyl]-N,1-dimethylpiperidin-4-amine |
| SMILES | CN1CCC(N(C)c2ccc(CNC3CC3)cc2)CC1 |
| InChI | InChI=1S/C17H27N3/c1-19-11-9-17(10-12-19)20(2)16-7-3-14(4-8-16)13-18-15-5-6-15/h3-4,7-8,15,17-18H,5-6,9-13H2,1-2H3 |
| InChIKey | RZSNHRKNXYERLW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|