C15H25NSi — CID 103438072
3-methyl-N-[(4-trimethylsilylphenyl)methyl]cyclobutan-1-amine (PubChem CID 103438072) has the molecular formula C15H25NSi and a molecular weight of 247.46 g/mol. Its IUPAC name is 3-methyl-N-[(4-trimethylsilylphenyl)methyl]cyclobutan-1-amine.
| Compound Name | 3-methyl-N-[(4-trimethylsilylphenyl)methyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 103438072 |
| Molecular Formula | C15H25NSi |
| Molecular Weight | 247.46 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 3-methyl-N-[(4-trimethylsilylphenyl)methyl]cyclobutan-1-amine |
| SMILES | CC1CC(NCc2ccc([Si](C)(C)C)cc2)C1 |
| InChI | InChI=1S/C15H25NSi/c1-12-9-14(10-12)16-11-13-5-7-15(8-6-13)17(2,3)4/h5-8,12,14,16H,9-11H2,1-4H3 |
| InChIKey | DICRZVVLBWSJHT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|