C9H9N3O2S2 — CID 169363188
4-[[(cyanoamino)-methylsulfanylmethylidene]amino]benzenesulfinic acid (PubChem CID 169363188) has the molecular formula C9H9N3O2S2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 4-[[(cyanoamino)-methylsulfanylmethylidene]amino]benzenesulfinic acid.
| Compound Name | 4-[[(cyanoamino)-methylsulfanylmethylidene]amino]benzenesulfinic acid |
|---|---|
| PubChem CID | 169363188 |
| Molecular Formula | C9H9N3O2S2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 4-[[(cyanoamino)-methylsulfanylmethylidene]amino]benzenesulfinic acid |
| SMILES | CS/C(=N\c1ccc(S(=O)O)cc1)NC#N |
| InChI | InChI=1S/C9H9N3O2S2/c1-15-9(11-6-10)12-7-2-4-8(5-3-7)16(13)14/h2-5H,1H3,(H,11,12)(H,13,14) |
| InChIKey | WPUZQZXOTLUFNY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 85.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|