C12H15N3S — CID 129132031
methyl N-cyano-N'-(3,4,5-trimethylphenyl)carbamimidothioate (PubChem CID 129132031) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is methyl N-cyano-N'-(3,4,5-trimethylphenyl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(3,4,5-trimethylphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 129132031 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | methyl N-cyano-N'-(3,4,5-trimethylphenyl)carbamimidothioate |
| SMILES | CS/C(=N\c1cc(C)c(C)c(C)c1)NC#N |
| InChI | InChI=1S/C12H15N3S/c1-8-5-11(6-9(2)10(8)3)15-12(16-4)14-7-13/h5-6H,1-4H3,(H,14,15) |
| InChIKey | XZIOUPKVDCAWMT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|