C17H16N4OS — CID 169362660
methyl N'-(4-benzamido-3-methylphenyl)-N-cyanocarbamimidothioate (PubChem CID 169362660) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is methyl N'-(4-benzamido-3-methylphenyl)-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-(4-benzamido-3-methylphenyl)-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169362660 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | methyl N'-(4-benzamido-3-methylphenyl)-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1ccc(NC(=O)c2ccccc2)c(C)c1)NC#N |
| InChI | InChI=1S/C17H16N4OS/c1-12-10-14(20-17(23-2)19-11-18)8-9-15(12)21-16(22)13-6-4-3-5-7-13/h3-10H,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | WIRAHDPDNUNILM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|