C14H18N4O2S — CID 169361128
5-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-(diethylamino)benzoic acid (PubChem CID 169361128) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 5-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-(diethylamino)benzoic acid.
| Compound Name | 5-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-(diethylamino)benzoic acid |
|---|---|
| PubChem CID | 169361128 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 5-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-(diethylamino)benzoic acid |
| SMILES | CCN(CC)c1ccc(/N=C(/NC#N)SC)cc1C(=O)O |
| InChI | InChI=1S/C14H18N4O2S/c1-4-18(5-2)12-7-6-10(8-11(12)13(19)20)17-14(21-3)16-9-15/h6-8H,4-5H2,1-3H3,(H,16,17)(H,19,20) |
| InChIKey | LXDDMBBNORODDC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|