C18H16N4S2 — CID 129016065
methyl N-cyano-N'-[4-(4-cyanophenyl)sulfanyl-3,5-dimethylphenyl]carbamimidothioate (PubChem CID 129016065) has the molecular formula C18H16N4S2 and a molecular weight of 352.49 g/mol. Its IUPAC name is methyl N-cyano-N'-[4-(4-cyanophenyl)sulfanyl-3,5-dimethylphenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[4-(4-cyanophenyl)sulfanyl-3,5-dimethylphenyl]carbamimidothioate |
|---|---|
| PubChem CID | 129016065 |
| Molecular Formula | C18H16N4S2 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | methyl N-cyano-N'-[4-(4-cyanophenyl)sulfanyl-3,5-dimethylphenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1cc(C)c(Sc2ccc(C#N)cc2)c(C)c1)NC#N |
| InChI | InChI=1S/C18H16N4S2/c1-12-8-15(22-18(23-3)21-11-20)9-13(2)17(12)24-16-6-4-14(10-19)5-7-16/h4-9H,1-3H3,(H,21,22) |
| InChIKey | HACQIIWCBJIALX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 71.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|