C15H8F5N3S2 — CID 169363848
methyl N-cyano-N'-[4-(2,3,4,5,6-pentafluorophenyl)sulfanylphenyl]carbamimidothioate (PubChem CID 169363848) has the molecular formula C15H8F5N3S2 and a molecular weight of 389.37 g/mol. Its IUPAC name is methyl N-cyano-N'-[4-(2,3,4,5,6-pentafluorophenyl)sulfanylphenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[4-(2,3,4,5,6-pentafluorophenyl)sulfanylphenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169363848 |
| Molecular Formula | C15H8F5N3S2 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | methyl N-cyano-N'-[4-(2,3,4,5,6-pentafluorophenyl)sulfanylphenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1ccc(Sc2c(F)c(F)c(F)c(F)c2F)cc1)NC#N |
| InChI | InChI=1S/C15H8F5N3S2/c1-24-15(22-6-21)23-7-2-4-8(5-3-7)25-14-12(19)10(17)9(16)11(18)13(14)20/h2-5H,1H3,(H,22,23) |
| InChIKey | ZANRCTFCBYIDCP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|