C13H12F3N3S — CID 169364197
methyl N-cyano-N'-[4-[1-(trifluoromethyl)cyclopropyl]phenyl]carbamimidothioate (PubChem CID 169364197) has the molecular formula C13H12F3N3S and a molecular weight of 299.32 g/mol. Its IUPAC name is methyl N-cyano-N'-[4-[1-(trifluoromethyl)cyclopropyl]phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[4-[1-(trifluoromethyl)cyclopropyl]phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169364197 |
| Molecular Formula | C13H12F3N3S |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | methyl N-cyano-N'-[4-[1-(trifluoromethyl)cyclopropyl]phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1ccc(C2(C(F)(F)F)CC2)cc1)NC#N |
| InChI | InChI=1S/C13H12F3N3S/c1-20-11(18-8-17)19-10-4-2-9(3-5-10)12(6-7-12)13(14,15)16/h2-5H,6-7H2,1H3,(H,18,19) |
| InChIKey | OJBPXSGRJGEEPQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|