C18H25N5OS — CID 169362003
methyl N-cyano-N'-[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]carbamimidothioate (PubChem CID 169362003) has the molecular formula C18H25N5OS and a molecular weight of 359.50 g/mol. Its IUPAC name is methyl N-cyano-N'-[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169362003 |
| Molecular Formula | C18H25N5OS |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | methyl N-cyano-N'-[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1ccc(N2CCN(C(=O)C(C)(C)C)CC2)cc1)NC#N |
| InChI | InChI=1S/C18H25N5OS/c1-18(2,3)16(24)23-11-9-22(10-12-23)15-7-5-14(6-8-15)21-17(25-4)20-13-19/h5-8H,9-12H2,1-4H3,(H,20,21) |
| InChIKey | ADUYLDYYMCQREV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 71.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|