C17H25N5O2S2 — CID 169362567
methyl N-cyano-N'-[5-(4-methylpiperazin-1-yl)-2-propan-2-ylsulfonylphenyl]carbamimidothioate (PubChem CID 169362567) has the molecular formula C17H25N5O2S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is methyl N-cyano-N'-[5-(4-methylpiperazin-1-yl)-2-propan-2-ylsulfonylphenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[5-(4-methylpiperazin-1-yl)-2-propan-2-ylsulfonylphenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169362567 |
| Molecular Formula | C17H25N5O2S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | methyl N-cyano-N'-[5-(4-methylpiperazin-1-yl)-2-propan-2-ylsulfonylphenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1cc(N2CCN(C)CC2)ccc1S(=O)(=O)C(C)C)NC#N |
| InChI | InChI=1S/C17H25N5O2S2/c1-13(2)26(23,24)16-6-5-14(22-9-7-21(3)8-10-22)11-15(16)20-17(25-4)19-12-18/h5-6,11,13H,7-10H2,1-4H3,(H,19,20) |
| InChIKey | RWSVDNVFZINVGI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|