C17H21N5O2S — CID 169340570
2-[(5-piperidin-1-yl-2-propan-2-ylsulfonylphenyl)hydrazinylidene]propanedinitrile (PubChem CID 169340570) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is 2-[(5-piperidin-1-yl-2-propan-2-ylsulfonylphenyl)hydrazinylidene]propanedinitrile.
| Compound Name | 2-[(5-piperidin-1-yl-2-propan-2-ylsulfonylphenyl)hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169340570 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-[(5-piperidin-1-yl-2-propan-2-ylsulfonylphenyl)hydrazinylidene]propanedinitrile |
| SMILES | CC(C)S(=O)(=O)c1ccc(N2CCCCC2)cc1NN=C(C#N)C#N |
| InChI | InChI=1S/C17H21N5O2S/c1-13(2)25(23,24)17-7-6-15(22-8-4-3-5-9-22)10-16(17)21-20-14(11-18)12-19/h6-7,10,13,21H,3-5,8-9H2,1-2H3 |
| InChIKey | RTSNTFZKUYQXMO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 109.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|