C23H26N2O4S — CID 168518036
2-[5-(azepan-1-yl)-2-propan-2-ylsulfonylphenyl]isoindole-1,3-dione (PubChem CID 168518036) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-[5-(azepan-1-yl)-2-propan-2-ylsulfonylphenyl]isoindole-1,3-dione.
| Compound Name | 2-[5-(azepan-1-yl)-2-propan-2-ylsulfonylphenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168518036 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 2-[5-(azepan-1-yl)-2-propan-2-ylsulfonylphenyl]isoindole-1,3-dione |
| SMILES | CC(C)S(=O)(=O)c1ccc(N2CCCCCC2)cc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H26N2O4S/c1-16(2)30(28,29)21-12-11-17(24-13-7-3-4-8-14-24)15-20(21)25-22(26)18-9-5-6-10-19(18)23(25)27/h5-6,9-12,15-16H,3-4,7-8,13-14H2,1-2H3 |
| InChIKey | ZZFFWNIMOVCKFX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|