C16H24ClN3O2S — CID 169368298
2-chloro-N'-(5-piperidin-1-yl-2-propan-2-ylsulfonylphenyl)ethanimidamide (PubChem CID 169368298) has the molecular formula C16H24ClN3O2S and a molecular weight of 357.91 g/mol. Its IUPAC name is 2-chloro-N'-(5-piperidin-1-yl-2-propan-2-ylsulfonylphenyl)ethanimidamide.
| Compound Name | 2-chloro-N'-(5-piperidin-1-yl-2-propan-2-ylsulfonylphenyl)ethanimidamide |
|---|---|
| PubChem CID | 169368298 |
| Molecular Formula | C16H24ClN3O2S |
| Molecular Weight | 357.91 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-chloro-N'-(5-piperidin-1-yl-2-propan-2-ylsulfonylphenyl)ethanimidamide |
| SMILES | CC(C)S(=O)(=O)c1ccc(N2CCCCC2)cc1/N=C(/N)CCl |
| InChI | InChI=1S/C16H24ClN3O2S/c1-12(2)23(21,22)15-7-6-13(20-8-4-3-5-9-20)10-14(15)19-16(18)11-17/h6-7,10,12H,3-5,8-9,11H2,1-2H3,(H2,18,19) |
| InChIKey | JJMRFLOLYRIPAA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.91 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|