C16H27N7O2S — CID 168603786
1-(diaminomethylidene)-2-[5-(4-methylpiperazin-1-yl)-2-propan-2-ylsulfonylphenyl]guanidine (PubChem CID 168603786) has the molecular formula C16H27N7O2S and a molecular weight of 381.51 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[5-(4-methylpiperazin-1-yl)-2-propan-2-ylsulfonylphenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[5-(4-methylpiperazin-1-yl)-2-propan-2-ylsulfonylphenyl]guanidine |
|---|---|
| PubChem CID | 168603786 |
| Molecular Formula | C16H27N7O2S |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-(diaminomethylidene)-2-[5-(4-methylpiperazin-1-yl)-2-propan-2-ylsulfonylphenyl]guanidine |
| SMILES | CC(C)S(=O)(=O)c1ccc(N2CCN(C)CC2)cc1/N=C(\N)N=C(N)N |
| InChI | InChI=1S/C16H27N7O2S/c1-11(2)26(24,25)14-5-4-12(23-8-6-22(3)7-9-23)10-13(14)20-16(19)21-15(17)18/h4-5,10-11H,6-9H2,1-3H3,(H6,17,18,19,20,21) |
| InChIKey | FTSLNJKAANOPSV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 143.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|