C23H28N4O — CID 57403295
2,7-bis(4-methylpiperazin-1-yl)fluoren-9-one (PubChem CID 57403295) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 2,7-bis(4-methylpiperazin-1-yl)fluoren-9-one.
| Compound Name | 2,7-bis(4-methylpiperazin-1-yl)fluoren-9-one |
|---|---|
| PubChem CID | 57403295 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 2,7-bis(4-methylpiperazin-1-yl)fluoren-9-one |
| SMILES | CN1CCN(c2ccc3c(c2)C(=O)c2cc(N4CCN(C)CC4)ccc2-3)CC1 |
| InChI | InChI=1S/C23H28N4O/c1-24-7-11-26(12-8-24)17-3-5-19-20-6-4-18(27-13-9-25(2)10-14-27)16-22(20)23(28)21(19)15-17/h3-6,15-16H,7-14H2,1-2H3 |
| InChIKey | DJVVVZJIWWEDHF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |