C20H17NO4 — CID 154125331
9,10-dioxo-6-piperidin-1-ylanthracene-2-carboxylic acid (PubChem CID 154125331) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 9,10-dioxo-6-piperidin-1-ylanthracene-2-carboxylic acid.
| Compound Name | 9,10-dioxo-6-piperidin-1-ylanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 154125331 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 9,10-dioxo-6-piperidin-1-ylanthracene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)c1ccc(N3CCCCC3)cc1C2=O |
| InChI | InChI=1S/C20H17NO4/c22-18-15-7-5-13(21-8-2-1-3-9-21)11-17(15)19(23)14-6-4-12(20(24)25)10-16(14)18/h4-7,10-11H,1-3,8-9H2,(H,24,25) |
| InChIKey | YRWWYXRRHICEFZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|