C15H9LiO4 — CID 174801705
lithium;9,10-dioxoanthracene-2-carboxylic acid;hydride (PubChem CID 174801705) has the molecular formula C15H9LiO4 and a molecular weight of 260.17 g/mol. Its IUPAC name is lithium;9,10-dioxoanthracene-2-carboxylic acid;hydride.
| Compound Name | lithium;9,10-dioxoanthracene-2-carboxylic acid;hydride |
|---|---|
| PubChem CID | 174801705 |
| Molecular Formula | C15H9LiO4 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | lithium;9,10-dioxoanthracene-2-carboxylic acid;hydride |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)c1ccccc1C2=O.[H-].[Li+] |
| InChI | InChI=1S/C15H8O4.Li.H/c16-13-9-3-1-2-4-10(9)14(17)12-7-8(15(18)19)5-6-11(12)13;;/h1-7H,(H,18,19);;/q;+1;-1 |
| InChIKey | FWQPJIAKIRNMEQ-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|