2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid

C17H11NO5 — CID 10380616

IUPAC2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid
SMILESO=C(O)CNC(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O
InChIInChI=1S/C17H11NO5/c19-14(20)8-18-17(23)9-5-6-12-13(7-9)16(22)11-4-2-1-3-10(11)15(12)21/h1-7H,8H2,(H,18,23)(H,19,20)
InChIKeyBWKFLZCYESDCKX-UHFFFAOYSA-N
MW309.28 g/mol
LogP1.28
Rot. Bonds3

About 2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid

2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid (PubChem CID 10380616) has the molecular formula C17H11NO5 and a molecular weight of 309.28 g/mol. Its IUPAC name is 2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid.

Molecular Properties

Compound Name2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid
PubChem CID10380616
Molecular FormulaC17H11NO5
Molecular Weight309.28 g/mol
Exact Mass309.06
IUPAC Name2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid
SMILESO=C(O)CNC(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O
InChIInChI=1S/C17H11NO5/c19-14(20)8-18-17(23)9-5-6-12-13(7-9)16(22)11-4-2-1-3-10(11)15(12)21/h1-7H,8H2,(H,18,23)(H,19,20)
InChIKeyBWKFLZCYESDCKX-UHFFFAOYSA-N
XLogP1.28
TPSA100.54 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.28
LogP ≤ 51.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}

Analyze 2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid?
The IUPAC name of 2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid (CID 10380616) is 2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid.
What is the SMILES notation for 2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid?
The canonical SMILES for 2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid is O=C(O)CNC(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O.
What is the InChIKey of 2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid?
The InChIKey is BWKFLZCYESDCKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO5/c19-14(20)8-18-17(23)9-5-6-12-13(7-9)16(22)11-4-2-1-3-10(11)15(12)21/h1-7H,8H2,(H,18,23)(H,19,20).
What are the key properties of 2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid?
2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid has a molecular weight of 309.28 g/mol, XLogP of 1.28, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid is sourced from PubChem (CID 10380616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).