C17H11NO5 — CID 10380616
2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid (PubChem CID 10380616) has the molecular formula C17H11NO5 and a molecular weight of 309.28 g/mol. Its IUPAC name is 2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid.
| Compound Name | 2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 10380616 |
| Molecular Formula | C17H11NO5 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-[(9,10-dioxoanthracene-2-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H11NO5/c19-14(20)8-18-17(23)9-5-6-12-13(7-9)16(22)11-4-2-1-3-10(11)15(12)21/h1-7H,8H2,(H,18,23)(H,19,20) |
| InChIKey | BWKFLZCYESDCKX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|