C18H13NO5 — CID 72725647
3-[(9,10-dioxoanthracene-2-carbonyl)amino]propanoic acid (PubChem CID 72725647) has the molecular formula C18H13NO5 and a molecular weight of 323.30 g/mol. Its IUPAC name is 3-[(9,10-dioxoanthracene-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-[(9,10-dioxoanthracene-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 72725647 |
| Molecular Formula | C18H13NO5 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 3-[(9,10-dioxoanthracene-2-carbonyl)amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H13NO5/c20-15(21)7-8-19-18(24)10-5-6-13-14(9-10)17(23)12-4-2-1-3-11(12)16(13)22/h1-6,9H,7-8H2,(H,19,24)(H,20,21) |
| InChIKey | WOFMMJHEBMTVIQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|