C23H23NO5 — CID 159141473
tert-butyl 4-[(9,10-dioxoanthracene-2-carbonyl)amino]butanoate (PubChem CID 159141473) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is tert-butyl 4-[(9,10-dioxoanthracene-2-carbonyl)amino]butanoate.
| Compound Name | tert-butyl 4-[(9,10-dioxoanthracene-2-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 159141473 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | tert-butyl 4-[(9,10-dioxoanthracene-2-carbonyl)amino]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCNC(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H23NO5/c1-23(2,3)29-19(25)9-6-12-24-22(28)14-10-11-17-18(13-14)21(27)16-8-5-4-7-15(16)20(17)26/h4-5,7-8,10-11,13H,6,9,12H2,1-3H3,(H,24,28) |
| InChIKey | KIDJMEJXPOPZCF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|