C23H24N2O4 — CID 91508010
tert-butyl N-[2-[(10-methylidene-9-oxoanthracene-2-carbonyl)amino]ethyl]carbamate (PubChem CID 91508010) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is tert-butyl N-[2-[(10-methylidene-9-oxoanthracene-2-carbonyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(10-methylidene-9-oxoanthracene-2-carbonyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 91508010 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | tert-butyl N-[2-[(10-methylidene-9-oxoanthracene-2-carbonyl)amino]ethyl]carbamate |
| SMILES | C=C1c2ccccc2C(=O)c2cc(C(=O)NCCNC(=O)OC(C)(C)C)ccc21 |
| InChI | InChI=1S/C23H24N2O4/c1-14-16-7-5-6-8-18(16)20(26)19-13-15(9-10-17(14)19)21(27)24-11-12-25-22(28)29-23(2,3)4/h5-10,13H,1,11-12H2,2-4H3,(H,24,27)(H,25,28) |
| InChIKey | DEMCQZYABUINRM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|