C23H25NO4 — CID 60521776
ethyl 7-[(9-oxofluorene-2-carbonyl)amino]heptanoate (PubChem CID 60521776) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is ethyl 7-[(9-oxofluorene-2-carbonyl)amino]heptanoate.
| Compound Name | ethyl 7-[(9-oxofluorene-2-carbonyl)amino]heptanoate |
|---|---|
| PubChem CID | 60521776 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | ethyl 7-[(9-oxofluorene-2-carbonyl)amino]heptanoate |
| SMILES | CCOC(=O)CCCCCCNC(=O)c1ccc2c(c1)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C23H25NO4/c1-2-28-21(25)11-5-3-4-8-14-24-23(27)16-12-13-18-17-9-6-7-10-19(17)22(26)20(18)15-16/h6-7,9-10,12-13,15H,2-5,8,11,14H2,1H3,(H,24,27) |
| InChIKey | XCFLCKVEOXHRAX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|