C28H37N3O3 — CID 148523711
N-[9-(4-aminobutylamino)nonyl]-9,10-dioxoanthracene-2-carboxamide (PubChem CID 148523711) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is N-[9-(4-aminobutylamino)nonyl]-9,10-dioxoanthracene-2-carboxamide.
| Compound Name | N-[9-(4-aminobutylamino)nonyl]-9,10-dioxoanthracene-2-carboxamide |
|---|---|
| PubChem CID | 148523711 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N-[9-(4-aminobutylamino)nonyl]-9,10-dioxoanthracene-2-carboxamide |
| SMILES | NCCCCNCCCCCCCCCNC(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C28H37N3O3/c29-16-8-11-18-30-17-9-4-2-1-3-5-10-19-31-28(34)21-14-15-24-25(20-21)27(33)23-13-7-6-12-22(23)26(24)32/h6-7,12-15,20,30H,1-5,8-11,16-19,29H2,(H,31,34) |
| InChIKey | MOXJLJLWFZHEBJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|