C18H13NO3 — CID 122602735
9,10-dioxo-N-prop-2-enylanthracene-2-carboxamide (PubChem CID 122602735) has the molecular formula C18H13NO3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 9,10-dioxo-N-prop-2-enylanthracene-2-carboxamide.
| Compound Name | 9,10-dioxo-N-prop-2-enylanthracene-2-carboxamide |
|---|---|
| PubChem CID | 122602735 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 9,10-dioxo-N-prop-2-enylanthracene-2-carboxamide |
| SMILES | C=CCNC(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H13NO3/c1-2-9-19-18(22)11-7-8-14-15(10-11)17(21)13-6-4-3-5-12(13)16(14)20/h2-8,10H,1,9H2,(H,19,22) |
| InChIKey | VGSDEKJPTKXXRP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|