C18H12O4 — CID 59816781
prop-2-enyl 9,10-dioxoanthracene-2-carboxylate (PubChem CID 59816781) has the molecular formula C18H12O4 and a molecular weight of 292.29 g/mol. Its IUPAC name is prop-2-enyl 9,10-dioxoanthracene-2-carboxylate.
| Compound Name | prop-2-enyl 9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 59816781 |
| Molecular Formula | C18H12O4 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | prop-2-enyl 9,10-dioxoanthracene-2-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H12O4/c1-2-9-22-18(21)11-7-8-14-15(10-11)17(20)13-6-4-3-5-12(13)16(14)19/h2-8,10H,1,9H2 |
| InChIKey | MCBNNDADEMBKMQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|