About prop-2-enyl 9,10-dioxoanthracene-2-carboxylate
prop-2-enyl 9,10-dioxoanthracene-2-carboxylate (PubChem CID 59816781) has the molecular formula C18H12O4
and a molecular weight of 292.29 g/mol. Its IUPAC name is prop-2-enyl 9,10-dioxoanthracene-2-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl 9,10-dioxoanthracene-2-carboxylate |
| PubChem CID | 59816781 |
| Molecular Formula | C18H12O4 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | prop-2-enyl 9,10-dioxoanthracene-2-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H12O4/c1-2-9-22-18(21)11-7-8-14-15(10-11)17(20)13-6-4-3-5-12(13)16(14)19/h2-8,10H,1,9H2 |
| InChIKey | MCBNNDADEMBKMQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 9,10-dioxoanthracene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 9,10-dioxoanthracene-2-carboxylate?
The IUPAC name of prop-2-enyl 9,10-dioxoanthracene-2-carboxylate (CID 59816781) is prop-2-enyl 9,10-dioxoanthracene-2-carboxylate.
What is the SMILES notation for prop-2-enyl 9,10-dioxoanthracene-2-carboxylate?
The canonical SMILES for prop-2-enyl 9,10-dioxoanthracene-2-carboxylate is C=CCOC(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O.
What is the InChIKey of prop-2-enyl 9,10-dioxoanthracene-2-carboxylate?
The InChIKey is MCBNNDADEMBKMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O4/c1-2-9-22-18(21)11-7-8-14-15(10-11)17(20)13-6-4-3-5-12(13)16(14)19/h2-8,10H,1,9H2.
What are the key properties of prop-2-enyl 9,10-dioxoanthracene-2-carboxylate?
prop-2-enyl 9,10-dioxoanthracene-2-carboxylate has a molecular weight of 292.29 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 9,10-dioxoanthracene-2-carboxylate is sourced from PubChem (CID 59816781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).