About prop-2-enyl 3-phenylbenzoate
prop-2-enyl 3-phenylbenzoate (PubChem CID 22594829) has the molecular formula C16H14O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is prop-2-enyl 3-phenylbenzoate.
Molecular Properties
| Compound Name | prop-2-enyl 3-phenylbenzoate |
| PubChem CID | 22594829 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | prop-2-enyl 3-phenylbenzoate |
| SMILES | C=CCOC(=O)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C16H14O2/c1-2-11-18-16(17)15-10-6-9-14(12-15)13-7-4-3-5-8-13/h2-10,12H,1,11H2 |
| InChIKey | PSRUXSKHGNABBU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 3-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 3-phenylbenzoate?
The IUPAC name of prop-2-enyl 3-phenylbenzoate (CID 22594829) is prop-2-enyl 3-phenylbenzoate.
What is the SMILES notation for prop-2-enyl 3-phenylbenzoate?
The canonical SMILES for prop-2-enyl 3-phenylbenzoate is C=CCOC(=O)c1cccc(-c2ccccc2)c1.
What is the InChIKey of prop-2-enyl 3-phenylbenzoate?
The InChIKey is PSRUXSKHGNABBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O2/c1-2-11-18-16(17)15-10-6-9-14(12-15)13-7-4-3-5-8-13/h2-10,12H,1,11H2.
What are the key properties of prop-2-enyl 3-phenylbenzoate?
prop-2-enyl 3-phenylbenzoate has a molecular weight of 238.29 g/mol, XLogP of 3.70, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 3-phenylbenzoate is sourced from PubChem (CID 22594829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).