About formic acid;prop-2-enyl benzoate
formic acid;prop-2-enyl benzoate (PubChem CID 174813743) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is formic acid;prop-2-enyl benzoate.
Molecular Properties
| Compound Name | formic acid;prop-2-enyl benzoate |
| PubChem CID | 174813743 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | formic acid;prop-2-enyl benzoate |
| SMILES | C=CCOC(=O)c1ccccc1.O=CO |
| InChI | InChI=1S/C10H10O2.CH2O2/c1-2-8-12-10(11)9-6-4-3-5-7-9;2-1-3/h2-7H,1,8H2;1H,(H,2,3) |
| InChIKey | IHCPNHUMPUZFKO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze formic acid;prop-2-enyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;prop-2-enyl benzoate?
The IUPAC name of formic acid;prop-2-enyl benzoate (CID 174813743) is formic acid;prop-2-enyl benzoate.
What is the SMILES notation for formic acid;prop-2-enyl benzoate?
The canonical SMILES for formic acid;prop-2-enyl benzoate is C=CCOC(=O)c1ccccc1.O=CO.
What is the InChIKey of formic acid;prop-2-enyl benzoate?
The InChIKey is IHCPNHUMPUZFKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2.CH2O2/c1-2-8-12-10(11)9-6-4-3-5-7-9;2-1-3/h2-7H,1,8H2;1H,(H,2,3).
What are the key properties of formic acid;prop-2-enyl benzoate?
formic acid;prop-2-enyl benzoate has a molecular weight of 208.21 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;prop-2-enyl benzoate is sourced from PubChem (CID 174813743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).