About [(E)-4-oxobut-2-enyl] benzoate
[(E)-4-oxobut-2-enyl] benzoate (PubChem CID 10943265) has the molecular formula C11H10O3
and a molecular weight of 190.20 g/mol. Its IUPAC name is [(E)-4-oxobut-2-enyl] benzoate.
Molecular Properties
| Compound Name | [(E)-4-oxobut-2-enyl] benzoate |
| PubChem CID | 10943265 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | [(E)-4-oxobut-2-enyl] benzoate |
| SMILES | O=C/C=C/COC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H10O3/c12-8-4-5-9-14-11(13)10-6-2-1-3-7-10/h1-8H,9H2/b5-4+ |
| InChIKey | JWJNIXCNQIEJFB-SNAWJCMRSA-N |
| XLogP | 1.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4-oxobut-2-enyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4-oxobut-2-enyl] benzoate?
The IUPAC name of [(E)-4-oxobut-2-enyl] benzoate (CID 10943265) is [(E)-4-oxobut-2-enyl] benzoate.
What is the SMILES notation for [(E)-4-oxobut-2-enyl] benzoate?
The canonical SMILES for [(E)-4-oxobut-2-enyl] benzoate is O=C/C=C/COC(=O)c1ccccc1.
What is the InChIKey of [(E)-4-oxobut-2-enyl] benzoate?
The InChIKey is JWJNIXCNQIEJFB-SNAWJCMRSA-N. The full InChI is InChI=1S/C11H10O3/c12-8-4-5-9-14-11(13)10-6-2-1-3-7-10/h1-8H,9H2/b5-4+.
What are the key properties of [(E)-4-oxobut-2-enyl] benzoate?
[(E)-4-oxobut-2-enyl] benzoate has a molecular weight of 190.20 g/mol, XLogP of 1.60, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4-oxobut-2-enyl] benzoate is sourced from PubChem (CID 10943265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).