About 2-benzoyloxyethyl benzoate;ethene
2-benzoyloxyethyl benzoate;ethene (PubChem CID 67969171) has the molecular formula C20H22O4
and a molecular weight of 326.39 g/mol. Its IUPAC name is 2-benzoyloxyethyl benzoate;ethene.
Molecular Properties
| Compound Name | 2-benzoyloxyethyl benzoate;ethene |
| PubChem CID | 67969171 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-benzoyloxyethyl benzoate;ethene |
| SMILES | C=C.C=C.O=C(OCCOC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H14O4.2C2H4/c17-15(13-7-3-1-4-8-13)19-11-12-20-16(18)14-9-5-2-6-10-14;2*1-2/h1-10H,11-12H2;2*1-2H2 |
| InChIKey | ISPLNNWOPUJMBC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-benzoyloxyethyl benzoate;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzoyloxyethyl benzoate;ethene?
The IUPAC name of 2-benzoyloxyethyl benzoate;ethene (CID 67969171) is 2-benzoyloxyethyl benzoate;ethene.
What is the SMILES notation for 2-benzoyloxyethyl benzoate;ethene?
The canonical SMILES for 2-benzoyloxyethyl benzoate;ethene is C=C.C=C.O=C(OCCOC(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of 2-benzoyloxyethyl benzoate;ethene?
The InChIKey is ISPLNNWOPUJMBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O4.2C2H4/c17-15(13-7-3-1-4-8-13)19-11-12-20-16(18)14-9-5-2-6-10-14;2*1-2/h1-10H,11-12H2;2*1-2H2.
What are the key properties of 2-benzoyloxyethyl benzoate;ethene?
2-benzoyloxyethyl benzoate;ethene has a molecular weight of 326.39 g/mol, XLogP of 4.30, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzoyloxyethyl benzoate;ethene is sourced from PubChem (CID 67969171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).