About 3-benzoyloxypropanoic acid
3-benzoyloxypropanoic acid (PubChem CID 21263483) has the molecular formula C10H10O4
and a molecular weight of 194.19 g/mol. Its IUPAC name is 3-benzoyloxypropanoic acid.
Molecular Properties
| Compound Name | 3-benzoyloxypropanoic acid |
| PubChem CID | 21263483 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 3-benzoyloxypropanoic acid |
| SMILES | O=C(O)CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C10H10O4/c11-9(12)6-7-14-10(13)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12) |
| InChIKey | ZFGVLYWWBSRAFN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-benzoyloxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzoyloxypropanoic acid?
The IUPAC name of 3-benzoyloxypropanoic acid (CID 21263483) is 3-benzoyloxypropanoic acid.
What is the SMILES notation for 3-benzoyloxypropanoic acid?
The canonical SMILES for 3-benzoyloxypropanoic acid is O=C(O)CCOC(=O)c1ccccc1.
What is the InChIKey of 3-benzoyloxypropanoic acid?
The InChIKey is ZFGVLYWWBSRAFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4/c11-9(12)6-7-14-10(13)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12).
What are the key properties of 3-benzoyloxypropanoic acid?
3-benzoyloxypropanoic acid has a molecular weight of 194.19 g/mol, XLogP of 1.32, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzoyloxypropanoic acid is sourced from PubChem (CID 21263483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).