About 3-oxobutyl benzoate
3-oxobutyl benzoate (PubChem CID 10899468) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is 3-oxobutyl benzoate.
Molecular Properties
| Compound Name | 3-oxobutyl benzoate |
| PubChem CID | 10899468 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 3-oxobutyl benzoate |
| SMILES | CC(=O)CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H12O3/c1-9(12)7-8-14-11(13)10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| InChIKey | YRRYDUBYQRWSRJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-oxobutyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxobutyl benzoate?
The IUPAC name of 3-oxobutyl benzoate (CID 10899468) is 3-oxobutyl benzoate.
What is the SMILES notation for 3-oxobutyl benzoate?
The canonical SMILES for 3-oxobutyl benzoate is CC(=O)CCOC(=O)c1ccccc1.
What is the InChIKey of 3-oxobutyl benzoate?
The InChIKey is YRRYDUBYQRWSRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c1-9(12)7-8-14-11(13)10-5-3-2-4-6-10/h2-6H,7-8H2,1H3.
What are the key properties of 3-oxobutyl benzoate?
3-oxobutyl benzoate has a molecular weight of 192.21 g/mol, XLogP of 1.82, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxobutyl benzoate is sourced from PubChem (CID 10899468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).