About propyl acetate;propyl benzoate
propyl acetate;propyl benzoate (PubChem CID 123140515) has the molecular formula C15H22O4
and a molecular weight of 266.34 g/mol. Its IUPAC name is propyl acetate;propyl benzoate.
Molecular Properties
| Compound Name | propyl acetate;propyl benzoate |
| PubChem CID | 123140515 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | propyl acetate;propyl benzoate |
| SMILES | CCCOC(=O)c1ccccc1.CCCOC(C)=O |
| InChI | InChI=1S/C10H12O2.C5H10O2/c1-2-8-12-10(11)9-6-4-3-5-7-9;1-3-4-7-5(2)6/h3-7H,2,8H2,1H3;3-4H2,1-2H3 |
| InChIKey | QYCAKSXUXCCKOJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propyl acetate;propyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl acetate;propyl benzoate?
The IUPAC name of propyl acetate;propyl benzoate (CID 123140515) is propyl acetate;propyl benzoate.
What is the SMILES notation for propyl acetate;propyl benzoate?
The canonical SMILES for propyl acetate;propyl benzoate is CCCOC(=O)c1ccccc1.CCCOC(C)=O.
What is the InChIKey of propyl acetate;propyl benzoate?
The InChIKey is QYCAKSXUXCCKOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.C5H10O2/c1-2-8-12-10(11)9-6-4-3-5-7-9;1-3-4-7-5(2)6/h3-7H,2,8H2,1H3;3-4H2,1-2H3.
What are the key properties of propyl acetate;propyl benzoate?
propyl acetate;propyl benzoate has a molecular weight of 266.34 g/mol, XLogP of 3.21, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl acetate;propyl benzoate is sourced from PubChem (CID 123140515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).