About propyl 3-acetylbenzoate
propyl 3-acetylbenzoate (PubChem CID 153251461) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is propyl 3-acetylbenzoate.
Molecular Properties
| Compound Name | propyl 3-acetylbenzoate |
| PubChem CID | 153251461 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | propyl 3-acetylbenzoate |
| SMILES | CCCOC(=O)c1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C12H14O3/c1-3-7-15-12(14)11-6-4-5-10(8-11)9(2)13/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | WTKKOVSIMMLVAC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propyl 3-acetylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 3-acetylbenzoate?
The IUPAC name of propyl 3-acetylbenzoate (CID 153251461) is propyl 3-acetylbenzoate.
What is the SMILES notation for propyl 3-acetylbenzoate?
The canonical SMILES for propyl 3-acetylbenzoate is CCCOC(=O)c1cccc(C(C)=O)c1.
What is the InChIKey of propyl 3-acetylbenzoate?
The InChIKey is WTKKOVSIMMLVAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-3-7-15-12(14)11-6-4-5-10(8-11)9(2)13/h4-6,8H,3,7H2,1-2H3.
What are the key properties of propyl 3-acetylbenzoate?
propyl 3-acetylbenzoate has a molecular weight of 206.24 g/mol, XLogP of 2.46, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 3-acetylbenzoate is sourced from PubChem (CID 153251461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).