About (5-hydroxy-3,4-dioxohexyl) benzoate
(5-hydroxy-3,4-dioxohexyl) benzoate (PubChem CID 54048606) has the molecular formula C13H14O5
and a molecular weight of 250.25 g/mol. Its IUPAC name is (5-hydroxy-3,4-dioxohexyl) benzoate.
Molecular Properties
| Compound Name | (5-hydroxy-3,4-dioxohexyl) benzoate |
| PubChem CID | 54048606 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (5-hydroxy-3,4-dioxohexyl) benzoate |
| SMILES | CC(O)C(=O)C(=O)CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H14O5/c1-9(14)12(16)11(15)7-8-18-13(17)10-5-3-2-4-6-10/h2-6,9,14H,7-8H2,1H3 |
| InChIKey | LRHDBXQLUWXBBZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (5-hydroxy-3,4-dioxohexyl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-hydroxy-3,4-dioxohexyl) benzoate?
The IUPAC name of (5-hydroxy-3,4-dioxohexyl) benzoate (CID 54048606) is (5-hydroxy-3,4-dioxohexyl) benzoate.
What is the SMILES notation for (5-hydroxy-3,4-dioxohexyl) benzoate?
The canonical SMILES for (5-hydroxy-3,4-dioxohexyl) benzoate is CC(O)C(=O)C(=O)CCOC(=O)c1ccccc1.
What is the InChIKey of (5-hydroxy-3,4-dioxohexyl) benzoate?
The InChIKey is LRHDBXQLUWXBBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O5/c1-9(14)12(16)11(15)7-8-18-13(17)10-5-3-2-4-6-10/h2-6,9,14H,7-8H2,1H3.
What are the key properties of (5-hydroxy-3,4-dioxohexyl) benzoate?
(5-hydroxy-3,4-dioxohexyl) benzoate has a molecular weight of 250.25 g/mol, XLogP of 0.75, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-hydroxy-3,4-dioxohexyl) benzoate is sourced from PubChem (CID 54048606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).