About 2-(methylamino)ethyl benzoate
2-(methylamino)ethyl benzoate (PubChem CID 158644589) has the molecular formula C20H26N2O4
and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-(methylamino)ethyl benzoate.
Molecular Properties
| Compound Name | 2-(methylamino)ethyl benzoate |
| PubChem CID | 158644589 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-(methylamino)ethyl benzoate |
| SMILES | CNCCOC(=O)c1ccccc1.CNCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/2C10H13NO2/c2*1-11-7-8-13-10(12)9-5-3-2-4-6-9/h2*2-6,11H,7-8H2,1H3 |
| InChIKey | IAUQKLSVPDSZPN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylamino)ethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)ethyl benzoate?
The IUPAC name of 2-(methylamino)ethyl benzoate (CID 158644589) is 2-(methylamino)ethyl benzoate.
What is the SMILES notation for 2-(methylamino)ethyl benzoate?
The canonical SMILES for 2-(methylamino)ethyl benzoate is CNCCOC(=O)c1ccccc1.CNCCOC(=O)c1ccccc1.
What is the InChIKey of 2-(methylamino)ethyl benzoate?
The InChIKey is IAUQKLSVPDSZPN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H13NO2/c2*1-11-7-8-13-10(12)9-5-3-2-4-6-9/h2*2-6,11H,7-8H2,1H3.
What are the key properties of 2-(methylamino)ethyl benzoate?
2-(methylamino)ethyl benzoate has a molecular weight of 358.44 g/mol, XLogP of 2.13, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)ethyl benzoate is sourced from PubChem (CID 158644589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).