C42H42O15 — CID 140775002
4-O-[2-[2-[4-[2-(2-benzoyloxyethoxy)ethoxycarbonyl]benzoyl]oxyethoxy]ethyl] 1-O-[2-(2-benzoyloxyethoxy)ethyl] benzene-1,4-dicarboxylate (PubChem CID 140775002) has the molecular formula C42H42O15 and a molecular weight of 786.78 g/mol. Its IUPAC name is 4-O-[2-[2-[4-[2-(2-benzoyloxyethoxy)ethoxycarbonyl]benzoyl]oxyethoxy]ethyl] 1-O-[2-(2-benzoyloxyethoxy)ethyl] benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[2-[2-[4-[2-(2-benzoyloxyethoxy)ethoxycarbonyl]benzoyl]oxyethoxy]ethyl] 1-O-[2-(2-benzoyloxyethoxy)ethyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 140775002 |
| Molecular Formula | C42H42O15 |
| Molecular Weight | 786.78 g/mol |
| Exact Mass | 786.25 |
| IUPAC Name | 4-O-[2-[2-[4-[2-(2-benzoyloxyethoxy)ethoxycarbonyl]benzoyl]oxyethoxy]ethyl] 1-O-[2-(2-benzoyloxyethoxy)ethyl] benzene-1,4-dicarboxylate |
| SMILES | O=C(OCCOCCOC(=O)c1ccc(C(=O)OCCOCCOC(=O)c2ccc(C(=O)OCCOCCOC(=O)c3ccccc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C42H42O15/c43-37(31-7-3-1-4-8-31)52-25-19-49-21-27-54-39(45)33-11-15-35(16-12-33)41(47)56-29-23-51-24-30-57-42(48)36-17-13-34(14-18-36)40(46)55-28-22-50-20-26-53-38(44)32-9-5-2-6-10-32/h1-18H,19-30H2 |
| InChIKey | ORFVZIXTRPOJLP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.78 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|