About 2-(aminomethoxy)ethyl benzoate
2-(aminomethoxy)ethyl benzoate (PubChem CID 89228347) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-(aminomethoxy)ethyl benzoate.
Molecular Properties
| Compound Name | 2-(aminomethoxy)ethyl benzoate |
| PubChem CID | 89228347 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 2-(aminomethoxy)ethyl benzoate |
| SMILES | NCOCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C10H13NO3/c11-8-13-6-7-14-10(12)9-4-2-1-3-5-9/h1-5H,6-8,11H2 |
| InChIKey | NYKVNMMUAFKDBY-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminomethoxy)ethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethoxy)ethyl benzoate?
The IUPAC name of 2-(aminomethoxy)ethyl benzoate (CID 89228347) is 2-(aminomethoxy)ethyl benzoate.
What is the SMILES notation for 2-(aminomethoxy)ethyl benzoate?
The canonical SMILES for 2-(aminomethoxy)ethyl benzoate is NCOCCOC(=O)c1ccccc1.
What is the InChIKey of 2-(aminomethoxy)ethyl benzoate?
The InChIKey is NYKVNMMUAFKDBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c11-8-13-6-7-14-10(12)9-4-2-1-3-5-9/h1-5H,6-8,11H2.
What are the key properties of 2-(aminomethoxy)ethyl benzoate?
2-(aminomethoxy)ethyl benzoate has a molecular weight of 195.22 g/mol, XLogP of 0.78, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethoxy)ethyl benzoate is sourced from PubChem (CID 89228347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).