About 2-(aminomethoxy)ethyl 4-propylbenzoate
2-(aminomethoxy)ethyl 4-propylbenzoate (PubChem CID 144917762) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(aminomethoxy)ethyl 4-propylbenzoate.
Molecular Properties
| Compound Name | 2-(aminomethoxy)ethyl 4-propylbenzoate |
| PubChem CID | 144917762 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-(aminomethoxy)ethyl 4-propylbenzoate |
| SMILES | CCCc1ccc(C(=O)OCCOCN)cc1 |
| InChI | InChI=1S/C13H19NO3/c1-2-3-11-4-6-12(7-5-11)13(15)17-9-8-16-10-14/h4-7H,2-3,8-10,14H2,1H3 |
| InChIKey | SCLARGWHELPIIX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminomethoxy)ethyl 4-propylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethoxy)ethyl 4-propylbenzoate?
The IUPAC name of 2-(aminomethoxy)ethyl 4-propylbenzoate (CID 144917762) is 2-(aminomethoxy)ethyl 4-propylbenzoate.
What is the SMILES notation for 2-(aminomethoxy)ethyl 4-propylbenzoate?
The canonical SMILES for 2-(aminomethoxy)ethyl 4-propylbenzoate is CCCc1ccc(C(=O)OCCOCN)cc1.
What is the InChIKey of 2-(aminomethoxy)ethyl 4-propylbenzoate?
The InChIKey is SCLARGWHELPIIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3/c1-2-3-11-4-6-12(7-5-11)13(15)17-9-8-16-10-14/h4-7H,2-3,8-10,14H2,1H3.
What are the key properties of 2-(aminomethoxy)ethyl 4-propylbenzoate?
2-(aminomethoxy)ethyl 4-propylbenzoate has a molecular weight of 237.30 g/mol, XLogP of 1.73, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethoxy)ethyl 4-propylbenzoate is sourced from PubChem (CID 144917762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).