About 2-nonoxyethyl benzoate
2-nonoxyethyl benzoate (PubChem CID 140608587) has the molecular formula C18H28O3
and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-nonoxyethyl benzoate.
Molecular Properties
| Compound Name | 2-nonoxyethyl benzoate |
| PubChem CID | 140608587 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-nonoxyethyl benzoate |
| SMILES | CCCCCCCCCOCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H28O3/c1-2-3-4-5-6-7-11-14-20-15-16-21-18(19)17-12-9-8-10-13-17/h8-10,12-13H,2-7,11,14-16H2,1H3 |
| InChIKey | PHKXHOUMDZEFSL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-nonoxyethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nonoxyethyl benzoate?
The IUPAC name of 2-nonoxyethyl benzoate (CID 140608587) is 2-nonoxyethyl benzoate.
What is the SMILES notation for 2-nonoxyethyl benzoate?
The canonical SMILES for 2-nonoxyethyl benzoate is CCCCCCCCCOCCOC(=O)c1ccccc1.
What is the InChIKey of 2-nonoxyethyl benzoate?
The InChIKey is PHKXHOUMDZEFSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O3/c1-2-3-4-5-6-7-11-14-20-15-16-21-18(19)17-12-9-8-10-13-17/h8-10,12-13H,2-7,11,14-16H2,1H3.
What are the key properties of 2-nonoxyethyl benzoate?
2-nonoxyethyl benzoate has a molecular weight of 292.42 g/mol, XLogP of 4.61, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nonoxyethyl benzoate is sourced from PubChem (CID 140608587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).