C20H24N2O6 — CID 22467709
2-[2-[2-(4-aminobenzoyl)oxyethoxy]ethoxy]ethyl 4-aminobenzoate (PubChem CID 22467709) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is 2-[2-[2-(4-aminobenzoyl)oxyethoxy]ethoxy]ethyl 4-aminobenzoate.
| Compound Name | 2-[2-[2-(4-aminobenzoyl)oxyethoxy]ethoxy]ethyl 4-aminobenzoate |
|---|---|
| PubChem CID | 22467709 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-[2-[2-(4-aminobenzoyl)oxyethoxy]ethoxy]ethyl 4-aminobenzoate |
| SMILES | Nc1ccc(C(=O)OCCOCCOCCOC(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O6/c21-17-5-1-15(2-6-17)19(23)27-13-11-25-9-10-26-12-14-28-20(24)16-3-7-18(22)8-4-16/h1-8H,9-14,21-22H2 |
| InChIKey | AOSGYCYKONQJHS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|