About azane;butyl 4-aminobenzoate
azane;butyl 4-aminobenzoate (PubChem CID 175088613) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is azane;butyl 4-aminobenzoate.
Molecular Properties
| Compound Name | azane;butyl 4-aminobenzoate |
| PubChem CID | 175088613 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | azane;butyl 4-aminobenzoate |
| SMILES | CCCCOC(=O)c1ccc(N)cc1.N |
| InChI | InChI=1S/C11H15NO2.H3N/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9;/h4-7H,2-3,8,12H2,1H3;1H3 |
| InChIKey | CFNCSEGKLCUMFS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze azane;butyl 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;butyl 4-aminobenzoate?
The IUPAC name of azane;butyl 4-aminobenzoate (CID 175088613) is azane;butyl 4-aminobenzoate.
What is the SMILES notation for azane;butyl 4-aminobenzoate?
The canonical SMILES for azane;butyl 4-aminobenzoate is CCCCOC(=O)c1ccc(N)cc1.N.
What is the InChIKey of azane;butyl 4-aminobenzoate?
The InChIKey is CFNCSEGKLCUMFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.H3N/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9;/h4-7H,2-3,8,12H2,1H3;1H3.
What are the key properties of azane;butyl 4-aminobenzoate?
azane;butyl 4-aminobenzoate has a molecular weight of 210.28 g/mol, XLogP of 2.39, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;butyl 4-aminobenzoate is sourced from PubChem (CID 175088613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).